C26H22F3N5O6 — CID 56999123
[[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)benzoyl]amino] 2,6-dimethyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-3,4-dihydropyridine-5-carboxylate (PubChem CID 56999123) has the molecular formula C26H22F3N5O6 and a molecular weight of 557.49 g/mol. Its IUPAC name is [[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)benzoyl]amino] 2,6-dimethyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-3,4-dihydropyridine-5-carboxylate.
| Compound Name | [[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)benzoyl]amino] 2,6-dimethyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 56999123 |
| Molecular Formula | C26H22F3N5O6 |
| Molecular Weight | 557.49 g/mol |
| Exact Mass | 557.15 |
| IUPAC Name | [[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)benzoyl]amino] 2,6-dimethyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-3,4-dihydropyridine-5-carboxylate |
| SMILES | CC1=NC(C)=C(C(=O)ONC(=O)c2ccc(C3=NNC(=O)CC3)cc2)C(c2ccccc2C(F)(F)F)C1[N+](=O)[O-] |
| InChI | InChI=1S/C26H22F3N5O6/c1-13-21(22(23(34(38)39)14(2)30-13)17-5-3-4-6-18(17)26(27,28)29)25(37)40-33-24(36)16-9-7-15(8-10-16)19-11-12-20(35)32-31-19/h3-10,22-23H,11-12H2,1-2H3,(H,32,35)(H,33,36) |
| InChIKey | XPQKVEZVJFIXLD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|