C24H25F3N4O6 — CID 54270440
8-[2,6-dimethyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-3,4-dihydropyridine-5-carbonyl]-2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione (PubChem CID 54270440) has the molecular formula C24H25F3N4O6 and a molecular weight of 522.48 g/mol. Its IUPAC name is 8-[2,6-dimethyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-3,4-dihydropyridine-5-carbonyl]-2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione.
| Compound Name | 8-[2,6-dimethyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-3,4-dihydropyridine-5-carbonyl]-2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione |
|---|---|
| PubChem CID | 54270440 |
| Molecular Formula | C24H25F3N4O6 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 8-[2,6-dimethyl-3-nitro-4-[2-(trifluoromethyl)phenyl]-3,4-dihydropyridine-5-carbonyl]-2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione |
| SMILES | CON1C(=O)CC2(CCN(C(=O)C3=C(C)N=C(C)C([N+](=O)[O-])C3c3ccccc3C(F)(F)F)CC2)C1=O |
| InChI | InChI=1S/C24H25F3N4O6/c1-13-18(21(33)29-10-8-23(9-11-29)12-17(32)30(37-3)22(23)34)19(20(31(35)36)14(2)28-13)15-6-4-5-7-16(15)24(25,26)27/h4-7,19-20H,8-12H2,1-3H3 |
| InChIKey | RJSQFXPQWQSIOD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 122.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|