C24H22N4O4 — CID 123923971
methyl 4-(1,3-diphenylpyrazol-4-yl)-2,6-dimethyl-3-nitro-3,4-dihydropyridine-5-carboxylate (PubChem CID 123923971) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is methyl 4-(1,3-diphenylpyrazol-4-yl)-2,6-dimethyl-3-nitro-3,4-dihydropyridine-5-carboxylate.
| Compound Name | methyl 4-(1,3-diphenylpyrazol-4-yl)-2,6-dimethyl-3-nitro-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 123923971 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | methyl 4-(1,3-diphenylpyrazol-4-yl)-2,6-dimethyl-3-nitro-3,4-dihydropyridine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)N=C(C)C([N+](=O)[O-])C1c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C24H22N4O4/c1-15-20(24(29)32-3)21(23(28(30)31)16(2)25-15)19-14-27(18-12-8-5-9-13-18)26-22(19)17-10-6-4-7-11-17/h4-14,21,23H,1-3H3 |
| InChIKey | IFSMBQCBQOHWMQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|