C14H12F3N3O5 — CID 16680618
methyl 6-methyl-3-nitro-2-oxo-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 16680618) has the molecular formula C14H12F3N3O5 and a molecular weight of 359.26 g/mol. Its IUPAC name is methyl 6-methyl-3-nitro-2-oxo-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl 6-methyl-3-nitro-2-oxo-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 16680618 |
| Molecular Formula | C14H12F3N3O5 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | methyl 6-methyl-3-nitro-2-oxo-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(=O)N([N+](=O)[O-])C1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H12F3N3O5/c1-7-10(12(21)25-2)11(19(20(23)24)13(22)18-7)8-5-3-4-6-9(8)14(15,16)17/h3-6,11H,1-2H3,(H,18,22) |
| InChIKey | PZBPFNRQHXIANC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|