C18H20F3NO4 — CID 13313713
dimethyl (2R,3S,4R)-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyridine-3,5-dicarboxylate (PubChem CID 13313713) has the molecular formula C18H20F3NO4 and a molecular weight of 371.36 g/mol. Its IUPAC name is dimethyl (2R,3S,4R)-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl (2R,3S,4R)-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 13313713 |
| Molecular Formula | C18H20F3NO4 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | dimethyl (2R,3S,4R)-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)N[C@H](C)[C@@H](C(=O)OC)[C@@H]1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H20F3NO4/c1-9-13(16(23)25-3)15(14(10(2)22-9)17(24)26-4)11-7-5-6-8-12(11)18(19,20)21/h5-9,13,15,22H,1-4H3/t9-,13-,15+/m1/s1 |
| InChIKey | PFWBDMRGAGHCLB-PKPZWWHKSA-N |
| XLogP | 3.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |