C14H17N3O4 — CID 12805018
2-methoxyethyl N-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamate (PubChem CID 12805018) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-methoxyethyl N-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamate.
| Compound Name | 2-methoxyethyl N-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 12805018 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-methoxyethyl N-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamate |
| SMILES | COCCOC(=O)Nc1ccc(C2=NNC(=O)CC2)cc1 |
| InChI | InChI=1S/C14H17N3O4/c1-20-8-9-21-14(19)15-11-4-2-10(3-5-11)12-6-7-13(18)17-16-12/h2-5H,6-9H2,1H3,(H,15,19)(H,17,18) |
| InChIKey | NGBKMIYVLRKUKB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|