C25H33F3N2O6 — CID 70397431
decyl [2,6-dimethyl-5-nitro-4-[2-(trifluoromethoxy)phenyl]-1,4-dihydropyridin-3-yl] carbonate (PubChem CID 70397431) has the molecular formula C25H33F3N2O6 and a molecular weight of 514.54 g/mol. Its IUPAC name is decyl [2,6-dimethyl-5-nitro-4-[2-(trifluoromethoxy)phenyl]-1,4-dihydropyridin-3-yl] carbonate.
| Compound Name | decyl [2,6-dimethyl-5-nitro-4-[2-(trifluoromethoxy)phenyl]-1,4-dihydropyridin-3-yl] carbonate |
|---|---|
| PubChem CID | 70397431 |
| Molecular Formula | C25H33F3N2O6 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | decyl [2,6-dimethyl-5-nitro-4-[2-(trifluoromethoxy)phenyl]-1,4-dihydropyridin-3-yl] carbonate |
| SMILES | CCCCCCCCCCOC(=O)OC1=C(C)NC(C)=C([N+](=O)[O-])C1c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C25H33F3N2O6/c1-4-5-6-7-8-9-10-13-16-34-24(31)35-23-18(3)29-17(2)22(30(32)33)21(23)19-14-11-12-15-20(19)36-25(26,27)28/h11-12,14-15,21,29H,4-10,13,16H2,1-3H3 |
| InChIKey | WJMJNLCJLHUVMJ-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|