C28H38N2O6 — CID 70472459
[4-(2-cyanophenyl)-5-decoxycarbonyloxy-2,6-dimethyl-1,4-dihydropyridin-3-yl] ethyl carbonate (PubChem CID 70472459) has the molecular formula C28H38N2O6 and a molecular weight of 498.62 g/mol. Its IUPAC name is [4-(2-cyanophenyl)-5-decoxycarbonyloxy-2,6-dimethyl-1,4-dihydropyridin-3-yl] ethyl carbonate.
| Compound Name | [4-(2-cyanophenyl)-5-decoxycarbonyloxy-2,6-dimethyl-1,4-dihydropyridin-3-yl] ethyl carbonate |
|---|---|
| PubChem CID | 70472459 |
| Molecular Formula | C28H38N2O6 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | [4-(2-cyanophenyl)-5-decoxycarbonyloxy-2,6-dimethyl-1,4-dihydropyridin-3-yl] ethyl carbonate |
| SMILES | CCCCCCCCCCOC(=O)OC1=C(C)NC(C)=C(OC(=O)OCC)C1c1ccccc1C#N |
| InChI | InChI=1S/C28H38N2O6/c1-5-7-8-9-10-11-12-15-18-34-28(32)36-26-21(4)30-20(3)25(35-27(31)33-6-2)24(26)23-17-14-13-16-22(23)19-29/h13-14,16-17,24,30H,5-12,15,18H2,1-4H3 |
| InChIKey | ONYIKJOOVSJECA-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 106.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|