C27H37Cl2NO6 — CID 70474320
[5-decoxycarbonyloxy-4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridin-3-yl] ethyl carbonate (PubChem CID 70474320) has the molecular formula C27H37Cl2NO6 and a molecular weight of 542.50 g/mol. Its IUPAC name is [5-decoxycarbonyloxy-4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridin-3-yl] ethyl carbonate.
| Compound Name | [5-decoxycarbonyloxy-4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridin-3-yl] ethyl carbonate |
|---|---|
| PubChem CID | 70474320 |
| Molecular Formula | C27H37Cl2NO6 |
| Molecular Weight | 542.50 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | [5-decoxycarbonyloxy-4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridin-3-yl] ethyl carbonate |
| SMILES | CCCCCCCCCCOC(=O)OC1=C(C)NC(C)=C(OC(=O)OCC)C1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C27H37Cl2NO6/c1-5-7-8-9-10-11-12-13-17-34-27(32)36-25-19(4)30-18(3)24(35-26(31)33-6-2)22(25)20-15-14-16-21(28)23(20)29/h14-16,22,30H,5-13,17H2,1-4H3 |
| InChIKey | GFLIVWMUVSPMCD-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.50 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|