C21H23Cl2NO8 — CID 23215646
[4-(2,3-dichlorophenyl)-5-methoxycarbonyloxy-2,6-dimethyl-1,4-dihydropyridin-3-yl]oxycarbonyloxymethyl butanoate (PubChem CID 23215646) has the molecular formula C21H23Cl2NO8 and a molecular weight of 488.32 g/mol. Its IUPAC name is [4-(2,3-dichlorophenyl)-5-methoxycarbonyloxy-2,6-dimethyl-1,4-dihydropyridin-3-yl]oxycarbonyloxymethyl butanoate.
| Compound Name | [4-(2,3-dichlorophenyl)-5-methoxycarbonyloxy-2,6-dimethyl-1,4-dihydropyridin-3-yl]oxycarbonyloxymethyl butanoate |
|---|---|
| PubChem CID | 23215646 |
| Molecular Formula | C21H23Cl2NO8 |
| Molecular Weight | 488.32 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | [4-(2,3-dichlorophenyl)-5-methoxycarbonyloxy-2,6-dimethyl-1,4-dihydropyridin-3-yl]oxycarbonyloxymethyl butanoate |
| SMILES | CCCC(=O)OCOC(=O)OC1=C(C)NC(C)=C(OC(=O)OC)C1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C21H23Cl2NO8/c1-5-7-15(25)29-10-30-21(27)32-19-12(3)24-11(2)18(31-20(26)28-4)16(19)13-8-6-9-14(22)17(13)23/h6,8-9,16,24H,5,7,10H2,1-4H3 |
| InChIKey | GCEXZXPETBIKES-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.32 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|