C19H23Cl2NO4 — CID 89242340
methyl 2-[4-(2,3-dichlorophenyl)-5-(ethylperoxymethyl)-2,6-dimethyl-1,4-dihydropyridin-3-yl]acetate (PubChem CID 89242340) has the molecular formula C19H23Cl2NO4 and a molecular weight of 400.30 g/mol. Its IUPAC name is methyl 2-[4-(2,3-dichlorophenyl)-5-(ethylperoxymethyl)-2,6-dimethyl-1,4-dihydropyridin-3-yl]acetate.
| Compound Name | methyl 2-[4-(2,3-dichlorophenyl)-5-(ethylperoxymethyl)-2,6-dimethyl-1,4-dihydropyridin-3-yl]acetate |
|---|---|
| PubChem CID | 89242340 |
| Molecular Formula | C19H23Cl2NO4 |
| Molecular Weight | 400.30 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | methyl 2-[4-(2,3-dichlorophenyl)-5-(ethylperoxymethyl)-2,6-dimethyl-1,4-dihydropyridin-3-yl]acetate |
| SMILES | CCOOCC1=C(C)NC(C)=C(CC(=O)OC)C1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H23Cl2NO4/c1-5-25-26-10-15-12(3)22-11(2)14(9-17(23)24-4)18(15)13-7-6-8-16(20)19(13)21/h6-8,18,22H,5,9-10H2,1-4H3 |
| InChIKey | OOQOWQGNELVLPS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.30 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|