C24H27Cl2NO6 — CID 100912025
(4S)-4-(2,3-dichlorophenyl)-5-(4,6-dioxononan-5-yloxycarbonyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 100912025) has the molecular formula C24H27Cl2NO6 and a molecular weight of 496.39 g/mol. Its IUPAC name is (4S)-4-(2,3-dichlorophenyl)-5-(4,6-dioxononan-5-yloxycarbonyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | (4S)-4-(2,3-dichlorophenyl)-5-(4,6-dioxononan-5-yloxycarbonyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 100912025 |
| Molecular Formula | C24H27Cl2NO6 |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | (4S)-4-(2,3-dichlorophenyl)-5-(4,6-dioxononan-5-yloxycarbonyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CCCC(=O)C(OC(=O)C1=C(C)NC(C)=C(C(=O)O)[C@@H]1c1cccc(Cl)c1Cl)C(=O)CCC |
| InChI | InChI=1S/C24H27Cl2NO6/c1-5-8-16(28)22(17(29)9-6-2)33-24(32)19-13(4)27-12(3)18(23(30)31)20(19)14-10-7-11-15(25)21(14)26/h7,10-11,20,22,27H,5-6,8-9H2,1-4H3,(H,30,31)/t20-/m0/s1 |
| InChIKey | PKRNNVCAQBOMEA-FQEVSTJZSA-N |
| XLogP | 4.96 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|