C17H17Cl2NO6 — CID 154124082
4-(2,3-dichlorophenyl)-2-(dimethoxymethyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 154124082) has the molecular formula C17H17Cl2NO6 and a molecular weight of 402.23 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)-2-(dimethoxymethyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 4-(2,3-dichlorophenyl)-2-(dimethoxymethyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 154124082 |
| Molecular Formula | C17H17Cl2NO6 |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 4-(2,3-dichlorophenyl)-2-(dimethoxymethyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | COC(OC)C1=C(C(=O)O)C(c2cccc(Cl)c2Cl)C(C(=O)O)=C(C)N1 |
| InChI | InChI=1S/C17H17Cl2NO6/c1-7-10(15(21)22)11(8-5-4-6-9(18)13(8)19)12(16(23)24)14(20-7)17(25-2)26-3/h4-6,11,17,20H,1-3H3,(H,21,22)(H,23,24) |
| InChIKey | ZZNQRAVPEGIEJC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|