C25H27F2N3O6 — CID 70384040
2-[benzyl(methyl)amino]ethyl [4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] carbonate (PubChem CID 70384040) has the molecular formula C25H27F2N3O6 and a molecular weight of 503.50 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]ethyl [4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] carbonate.
| Compound Name | 2-[benzyl(methyl)amino]ethyl [4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] carbonate |
|---|---|
| PubChem CID | 70384040 |
| Molecular Formula | C25H27F2N3O6 |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 2-[benzyl(methyl)amino]ethyl [4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] carbonate |
| SMILES | CC1=C(OC(=O)OCCN(C)Cc2ccccc2)C(c2ccccc2OC(F)F)C([N+](=O)[O-])=C(C)N1 |
| InChI | InChI=1S/C25H27F2N3O6/c1-16-22(30(32)33)21(19-11-7-8-12-20(19)35-24(26)27)23(17(2)28-16)36-25(31)34-14-13-29(3)15-18-9-5-4-6-10-18/h4-12,21,24,28H,13-15H2,1-3H3 |
| InChIKey | XEBWLMQSSNDFAG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|