C28H33N3O8 — CID 70570479
[5-[2-[benzyl(methyl)amino]ethoxycarbonyloxy]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl] propan-2-yl carbonate (PubChem CID 70570479) has the molecular formula C28H33N3O8 and a molecular weight of 539.59 g/mol. Its IUPAC name is [5-[2-[benzyl(methyl)amino]ethoxycarbonyloxy]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl] propan-2-yl carbonate.
| Compound Name | [5-[2-[benzyl(methyl)amino]ethoxycarbonyloxy]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl] propan-2-yl carbonate |
|---|---|
| PubChem CID | 70570479 |
| Molecular Formula | C28H33N3O8 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | [5-[2-[benzyl(methyl)amino]ethoxycarbonyloxy]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl] propan-2-yl carbonate |
| SMILES | CC1=C(OC(=O)OCCN(C)Cc2ccccc2)C(c2cccc([N+](=O)[O-])c2)C(OC(=O)OC(C)C)=C(C)N1 |
| InChI | InChI=1S/C28H33N3O8/c1-18(2)37-28(33)39-26-20(4)29-19(3)25(24(26)22-12-9-13-23(16-22)31(34)35)38-27(32)36-15-14-30(5)17-21-10-7-6-8-11-21/h6-13,16,18,24,29H,14-15,17H2,1-5H3 |
| InChIKey | QHXMVHCWYPUFFP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|