C27H30N2O9 — CID 70484752
[2,6-dimethyl-4-(3-nitrophenyl)-5-propan-2-yloxycarbonyloxy-1,4-dihydropyridin-3-yl] (2-methoxy-2-phenylethyl) carbonate (PubChem CID 70484752) has the molecular formula C27H30N2O9 and a molecular weight of 526.54 g/mol. Its IUPAC name is [2,6-dimethyl-4-(3-nitrophenyl)-5-propan-2-yloxycarbonyloxy-1,4-dihydropyridin-3-yl] (2-methoxy-2-phenylethyl) carbonate.
| Compound Name | [2,6-dimethyl-4-(3-nitrophenyl)-5-propan-2-yloxycarbonyloxy-1,4-dihydropyridin-3-yl] (2-methoxy-2-phenylethyl) carbonate |
|---|---|
| PubChem CID | 70484752 |
| Molecular Formula | C27H30N2O9 |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | [2,6-dimethyl-4-(3-nitrophenyl)-5-propan-2-yloxycarbonyloxy-1,4-dihydropyridin-3-yl] (2-methoxy-2-phenylethyl) carbonate |
| SMILES | COC(COC(=O)OC1=C(C)NC(C)=C(OC(=O)OC(C)C)C1c1cccc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C27H30N2O9/c1-16(2)36-27(31)38-25-18(4)28-17(3)24(23(25)20-12-9-13-21(14-20)29(32)33)37-26(30)35-15-22(34-5)19-10-7-6-8-11-19/h6-14,16,22-23,28H,15H2,1-5H3 |
| InChIKey | BKBSZKUULDOUIK-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|