C25H33N3O8 — CID 70500359
propan-2-yl (4R)-5-[[(2R)-1-ethoxy-3-methyl-1-oxobutan-2-yl]carbamoyloxy]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 70500359) has the molecular formula C25H33N3O8 and a molecular weight of 503.55 g/mol. Its IUPAC name is propan-2-yl (4R)-5-[[(2R)-1-ethoxy-3-methyl-1-oxobutan-2-yl]carbamoyloxy]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | propan-2-yl (4R)-5-[[(2R)-1-ethoxy-3-methyl-1-oxobutan-2-yl]carbamoyloxy]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 70500359 |
| Molecular Formula | C25H33N3O8 |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | propan-2-yl (4R)-5-[[(2R)-1-ethoxy-3-methyl-1-oxobutan-2-yl]carbamoyloxy]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCOC(=O)[C@H](NC(=O)OC1=C(C)NC(C)=C(C(=O)OC(C)C)[C@H]1c1cccc([N+](=O)[O-])c1)C(C)C |
| InChI | InChI=1S/C25H33N3O8/c1-8-34-24(30)21(13(2)3)27-25(31)36-22-16(7)26-15(6)19(23(29)35-14(4)5)20(22)17-10-9-11-18(12-17)28(32)33/h9-14,20-21,26H,8H2,1-7H3,(H,27,31)/t20-,21-/m1/s1 |
| InChIKey | GYUYMLWPNJCPDI-NHCUHLMSSA-N |
| XLogP | 4.05 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|