C22H29N3O7S — CID 70466660
ethyl (2R)-2-[[(4S)-2,6-dimethyl-5-methylsulfonyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carbonyl]amino]-3-methylbutanoate (PubChem CID 70466660) has the molecular formula C22H29N3O7S and a molecular weight of 479.56 g/mol. Its IUPAC name is ethyl (2R)-2-[[(4S)-2,6-dimethyl-5-methylsulfonyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carbonyl]amino]-3-methylbutanoate.
| Compound Name | ethyl (2R)-2-[[(4S)-2,6-dimethyl-5-methylsulfonyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carbonyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 70466660 |
| Molecular Formula | C22H29N3O7S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | ethyl (2R)-2-[[(4S)-2,6-dimethyl-5-methylsulfonyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carbonyl]amino]-3-methylbutanoate |
| SMILES | CCOC(=O)[C@H](NC(=O)C1=C(C)NC(C)=C(S(C)(=O)=O)[C@H]1c1cccc([N+](=O)[O-])c1)C(C)C |
| InChI | InChI=1S/C22H29N3O7S/c1-7-32-22(27)19(12(2)3)24-21(26)17-13(4)23-14(5)20(33(6,30)31)18(17)15-9-8-10-16(11-15)25(28)29/h8-12,18-19,23H,7H2,1-6H3,(H,24,26)/t18-,19+/m0/s1 |
| InChIKey | HMBXXZUXVFFYPX-RBUKOAKNSA-N |
| XLogP | 2.54 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|