C23H33N2O7P — CID 13363701
methyl 5-dibutoxyphosphoryl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 13363701) has the molecular formula C23H33N2O7P and a molecular weight of 480.50 g/mol. Its IUPAC name is methyl 5-dibutoxyphosphoryl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | methyl 5-dibutoxyphosphoryl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 13363701 |
| Molecular Formula | C23H33N2O7P |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | methyl 5-dibutoxyphosphoryl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCCCOP(=O)(OCCCC)C1=C(C)NC(C)=C(C(=O)OC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H33N2O7P/c1-6-8-13-31-33(29,32-14-9-7-2)22-17(4)24-16(3)20(23(26)30-5)21(22)18-11-10-12-19(15-18)25(27)28/h10-12,15,21,24H,6-9,13-14H2,1-5H3 |
| InChIKey | AAGHLLHPTYOESO-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|