C31H37N5O6 — CID 70072344
methyl 2,6-dimethyl-5-[[3-methyl-1-oxo-1-(4-phenylpiperazin-1-yl)butan-2-yl]carbamoyl]-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 70072344) has the molecular formula C31H37N5O6 and a molecular weight of 575.67 g/mol. Its IUPAC name is methyl 2,6-dimethyl-5-[[3-methyl-1-oxo-1-(4-phenylpiperazin-1-yl)butan-2-yl]carbamoyl]-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | methyl 2,6-dimethyl-5-[[3-methyl-1-oxo-1-(4-phenylpiperazin-1-yl)butan-2-yl]carbamoyl]-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 70072344 |
| Molecular Formula | C31H37N5O6 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | methyl 2,6-dimethyl-5-[[3-methyl-1-oxo-1-(4-phenylpiperazin-1-yl)butan-2-yl]carbamoyl]-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)NC(C(=O)N2CCN(c3ccccc3)CC2)C(C)C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H37N5O6/c1-19(2)28(30(38)35-16-14-34(15-17-35)23-11-7-6-8-12-23)33-29(37)25-20(3)32-21(4)26(31(39)42-5)27(25)22-10-9-13-24(18-22)36(40)41/h6-13,18-19,27-28,32H,14-17H2,1-5H3,(H,33,37) |
| InChIKey | CQSLFGWKAXIZND-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 134.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|