C32H38N4O6 — CID 67575637
methyl 2,6-dimethyl-5-[[2-(3-methylbutanoyl)-4-phenylpiperidin-1-yl]carbamoyl]-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 67575637) has the molecular formula C32H38N4O6 and a molecular weight of 574.68 g/mol. Its IUPAC name is methyl 2,6-dimethyl-5-[[2-(3-methylbutanoyl)-4-phenylpiperidin-1-yl]carbamoyl]-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | methyl 2,6-dimethyl-5-[[2-(3-methylbutanoyl)-4-phenylpiperidin-1-yl]carbamoyl]-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 67575637 |
| Molecular Formula | C32H38N4O6 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | methyl 2,6-dimethyl-5-[[2-(3-methylbutanoyl)-4-phenylpiperidin-1-yl]carbamoyl]-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)NN2CCC(c3ccccc3)CC2C(=O)CC(C)C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C32H38N4O6/c1-19(2)16-27(37)26-18-23(22-10-7-6-8-11-22)14-15-35(26)34-31(38)28-20(3)33-21(4)29(32(39)42-5)30(28)24-12-9-13-25(17-24)36(40)41/h6-13,17,19,23,26,30,33H,14-16,18H2,1-5H3,(H,34,38) |
| InChIKey | GEFQBGLRTXCVGN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|