C23H27N3O6 — CID 67917493
5-O-[(3S)-1-azabicyclo[2.2.2]octan-3-yl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 67917493) has the molecular formula C23H27N3O6 and a molecular weight of 441.48 g/mol. Its IUPAC name is 5-O-[(3S)-1-azabicyclo[2.2.2]octan-3-yl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[(3S)-1-azabicyclo[2.2.2]octan-3-yl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 67917493 |
| Molecular Formula | C23H27N3O6 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 5-O-[(3S)-1-azabicyclo[2.2.2]octan-3-yl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)O[C@@H]2CN3CCC2CC3)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H27N3O6/c1-13-19(22(27)31-3)21(16-5-4-6-17(11-16)26(29)30)20(14(2)24-13)23(28)32-18-12-25-9-7-15(18)8-10-25/h4-6,11,15,18,21,24H,7-10,12H2,1-3H3/t18-,21?/m1/s1 |
| InChIKey | VMQHCOQZMBBRRU-ITUIMRKVSA-N |
| XLogP | 2.64 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|