C20H24N2O9 — CID 70471189
[2,6-dimethyl-4-(4-nitrophenyl)-5-propan-2-yloxycarbonyloxy-1,4-dihydropyridin-3-yl] 2-hydroxyethyl carbonate (PubChem CID 70471189) has the molecular formula C20H24N2O9 and a molecular weight of 436.42 g/mol. Its IUPAC name is [2,6-dimethyl-4-(4-nitrophenyl)-5-propan-2-yloxycarbonyloxy-1,4-dihydropyridin-3-yl] 2-hydroxyethyl carbonate.
| Compound Name | [2,6-dimethyl-4-(4-nitrophenyl)-5-propan-2-yloxycarbonyloxy-1,4-dihydropyridin-3-yl] 2-hydroxyethyl carbonate |
|---|---|
| PubChem CID | 70471189 |
| Molecular Formula | C20H24N2O9 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | [2,6-dimethyl-4-(4-nitrophenyl)-5-propan-2-yloxycarbonyloxy-1,4-dihydropyridin-3-yl] 2-hydroxyethyl carbonate |
| SMILES | CC1=C(OC(=O)OCCO)C(c2ccc([N+](=O)[O-])cc2)C(OC(=O)OC(C)C)=C(C)N1 |
| InChI | InChI=1S/C20H24N2O9/c1-11(2)29-20(25)31-18-13(4)21-12(3)17(30-19(24)28-10-9-23)16(18)14-5-7-15(8-6-14)22(26)27/h5-8,11,16,21,23H,9-10H2,1-4H3 |
| InChIKey | YOJNJHHYIGEDLM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 146.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|