C22H23N3O6 — CID 70555762
[5-(2-cyanoethoxycarbonyloxy)-4-(3-cyanophenyl)-2,6-dimethyl-1,4-dihydropyridin-3-yl] propan-2-yl carbonate (PubChem CID 70555762) has the molecular formula C22H23N3O6 and a molecular weight of 425.44 g/mol. Its IUPAC name is [5-(2-cyanoethoxycarbonyloxy)-4-(3-cyanophenyl)-2,6-dimethyl-1,4-dihydropyridin-3-yl] propan-2-yl carbonate.
| Compound Name | [5-(2-cyanoethoxycarbonyloxy)-4-(3-cyanophenyl)-2,6-dimethyl-1,4-dihydropyridin-3-yl] propan-2-yl carbonate |
|---|---|
| PubChem CID | 70555762 |
| Molecular Formula | C22H23N3O6 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | [5-(2-cyanoethoxycarbonyloxy)-4-(3-cyanophenyl)-2,6-dimethyl-1,4-dihydropyridin-3-yl] propan-2-yl carbonate |
| SMILES | CC1=C(OC(=O)OCCC#N)C(c2cccc(C#N)c2)C(OC(=O)OC(C)C)=C(C)N1 |
| InChI | InChI=1S/C22H23N3O6/c1-13(2)29-22(27)31-20-15(4)25-14(3)19(30-21(26)28-10-6-9-23)18(20)17-8-5-7-16(11-17)12-24/h5,7-8,11,13,18,25H,6,10H2,1-4H3 |
| InChIKey | CFIDHCBMTFHCAN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|