C22H30N2O7 — CID 70460064
[5-(4-aminopentoxycarbonyloxy)-4-(3-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridin-3-yl] methyl carbonate (PubChem CID 70460064) has the molecular formula C22H30N2O7 and a molecular weight of 434.49 g/mol. Its IUPAC name is [5-(4-aminopentoxycarbonyloxy)-4-(3-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridin-3-yl] methyl carbonate.
| Compound Name | [5-(4-aminopentoxycarbonyloxy)-4-(3-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridin-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 70460064 |
| Molecular Formula | C22H30N2O7 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | [5-(4-aminopentoxycarbonyloxy)-4-(3-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridin-3-yl] methyl carbonate |
| SMILES | COC(=O)OC1=C(C)NC(C)=C(OC(=O)OCCCC(C)N)C1c1cccc(OC)c1 |
| InChI | InChI=1S/C22H30N2O7/c1-13(23)8-7-11-29-22(26)31-20-15(3)24-14(2)19(30-21(25)28-5)18(20)16-9-6-10-17(12-16)27-4/h6,9-10,12-13,18,24H,7-8,11,23H2,1-5H3 |
| InChIKey | ZNXBSBBBOPYZIC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|