C19H20N2O5 — CID 70040635
4-(3-cyanophenyl)-5-(1-methoxyethoxycarbonyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 70040635) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 4-(3-cyanophenyl)-5-(1-methoxyethoxycarbonyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 4-(3-cyanophenyl)-5-(1-methoxyethoxycarbonyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70040635 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 4-(3-cyanophenyl)-5-(1-methoxyethoxycarbonyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | COC(C)OC(=O)C1=C(C)NC(C)=C(C(=O)O)C1c1cccc(C#N)c1 |
| InChI | InChI=1S/C19H20N2O5/c1-10-15(18(22)23)17(14-7-5-6-13(8-14)9-20)16(11(2)21-10)19(24)26-12(3)25-4/h5-8,12,17,21H,1-4H3,(H,22,23) |
| InChIKey | VZJNCPHDDYNLPG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|