C26H34N2O5 — CID 158516244
formaldehyde;2-methoxyethyl 4-(3-cyanophenyl)-5-cycloheptyloxy-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate (PubChem CID 158516244) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is formaldehyde;2-methoxyethyl 4-(3-cyanophenyl)-5-cycloheptyloxy-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate.
| Compound Name | formaldehyde;2-methoxyethyl 4-(3-cyanophenyl)-5-cycloheptyloxy-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 158516244 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | formaldehyde;2-methoxyethyl 4-(3-cyanophenyl)-5-cycloheptyloxy-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate |
| SMILES | C=O.COCCOC(=O)C1=C(C)NC(C)=C(OC2CCCCCC2)C1c1cccc(C#N)c1 |
| InChI | InChI=1S/C25H32N2O4.CH2O/c1-17-22(25(28)30-14-13-29-3)23(20-10-8-9-19(15-20)16-26)24(18(2)27-17)31-21-11-6-4-5-7-12-21;1-2/h8-10,15,21,23,27H,4-7,11-14H2,1-3H3;1H2 |
| InChIKey | HLQTXNFJFKYQBK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|