C18H17N4O4- — CID 163167734
2-cyanoethyl 5-cyano-4-[3-[hydroxy(oxido)amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate (PubChem CID 163167734) has the molecular formula C18H17N4O4- and a molecular weight of 353.36 g/mol. Its IUPAC name is 2-cyanoethyl 5-cyano-4-[3-[hydroxy(oxido)amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate.
| Compound Name | 2-cyanoethyl 5-cyano-4-[3-[hydroxy(oxido)amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 163167734 |
| Molecular Formula | C18H17N4O4- |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-cyanoethyl 5-cyano-4-[3-[hydroxy(oxido)amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=C(C#N)C(c2cccc(N([O-])O)c2)C(C(=O)OCCC#N)=C(C)N1 |
| InChI | InChI=1S/C18H17N4O4/c1-11-15(10-20)17(13-5-3-6-14(9-13)22(24)25)16(12(2)21-11)18(23)26-8-4-7-19/h3,5-6,9,17,21,24H,4,8H2,1-2H3/q-1 |
| InChIKey | ZZXUNXBGANHLFC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 132.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|