C17H18ClN3O4 — CID 163122314
3-[3-(2-chloroethoxycarbonyl)-5-cyano-2,6-dimethyl-1,4-dihydropyridin-4-yl]-N-hydroxybenzeneamine oxide (PubChem CID 163122314) has the molecular formula C17H18ClN3O4 and a molecular weight of 363.80 g/mol. Its IUPAC name is 3-[3-(2-chloroethoxycarbonyl)-5-cyano-2,6-dimethyl-1,4-dihydropyridin-4-yl]-N-hydroxybenzeneamine oxide.
| Compound Name | 3-[3-(2-chloroethoxycarbonyl)-5-cyano-2,6-dimethyl-1,4-dihydropyridin-4-yl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163122314 |
| Molecular Formula | C17H18ClN3O4 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 3-[3-(2-chloroethoxycarbonyl)-5-cyano-2,6-dimethyl-1,4-dihydropyridin-4-yl]-N-hydroxybenzeneamine oxide |
| SMILES | CC1=C(C#N)C(c2cccc([NH+]([O-])O)c2)C(C(=O)OCCCl)=C(C)N1 |
| InChI | InChI=1S/C17H18ClN3O4/c1-10-14(9-19)16(12-4-3-5-13(8-12)21(23)24)15(11(2)20-10)17(22)25-7-6-18/h3-5,8,16,20-21,23H,6-7H2,1-2H3 |
| InChIKey | BYDPMBPYARMDMU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|