C18H21BrN2O6 — CID 163122757
3-[2-(bromomethyl)-3-ethoxycarbonyl-5-methoxycarbonyl-6-methyl-1,4-dihydropyridin-4-yl]-N-hydroxybenzeneamine oxide (PubChem CID 163122757) has the molecular formula C18H21BrN2O6 and a molecular weight of 441.28 g/mol. Its IUPAC name is 3-[2-(bromomethyl)-3-ethoxycarbonyl-5-methoxycarbonyl-6-methyl-1,4-dihydropyridin-4-yl]-N-hydroxybenzeneamine oxide.
| Compound Name | 3-[2-(bromomethyl)-3-ethoxycarbonyl-5-methoxycarbonyl-6-methyl-1,4-dihydropyridin-4-yl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163122757 |
| Molecular Formula | C18H21BrN2O6 |
| Molecular Weight | 441.28 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 3-[2-(bromomethyl)-3-ethoxycarbonyl-5-methoxycarbonyl-6-methyl-1,4-dihydropyridin-4-yl]-N-hydroxybenzeneamine oxide |
| SMILES | CCOC(=O)C1=C(CBr)NC(C)=C(C(=O)OC)C1c1cccc([NH+]([O-])O)c1 |
| InChI | InChI=1S/C18H21BrN2O6/c1-4-27-18(23)16-13(9-19)20-10(2)14(17(22)26-3)15(16)11-6-5-7-12(8-11)21(24)25/h5-8,15,20-21,24H,4,9H2,1-3H3 |
| InChIKey | CCJSITWGXWXFFW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 112.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|