C17H18N4O6-2 — CID 163153664
2-cyanoethyl (4R)-5-[hydroxy(oxido)amino]-4-[3-[hydroxy(oxido)amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate (PubChem CID 163153664) has the molecular formula C17H18N4O6-2 and a molecular weight of 374.35 g/mol. Its IUPAC name is 2-cyanoethyl (4R)-5-[hydroxy(oxido)amino]-4-[3-[hydroxy(oxido)amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate.
| Compound Name | 2-cyanoethyl (4R)-5-[hydroxy(oxido)amino]-4-[3-[hydroxy(oxido)amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 163153664 |
| Molecular Formula | C17H18N4O6-2 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-cyanoethyl (4R)-5-[hydroxy(oxido)amino]-4-[3-[hydroxy(oxido)amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OCCC#N)[C@@H](c2cccc(N([O-])O)c2)C(N([O-])O)=C(C)N1 |
| InChI | InChI=1S/C17H18N4O6/c1-10-14(17(22)27-8-4-7-18)15(16(21(25)26)11(2)19-10)12-5-3-6-13(9-12)20(23)24/h3,5-6,9,15,19,23,25H,4,8H2,1-2H3/q-2/t15-/m1/s1 |
| InChIKey | ORQUKHHUCZXAMX-OAHLLOKOSA-N |
| XLogP | 2.22 |
| TPSA | 155.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|