C25H35N3O9 — CID 70388119
[5-(5-amino-2,2-dimethylpentoxy)carbonyloxy-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl] 2-methoxyethyl carbonate (PubChem CID 70388119) has the molecular formula C25H35N3O9 and a molecular weight of 521.57 g/mol. Its IUPAC name is [5-(5-amino-2,2-dimethylpentoxy)carbonyloxy-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl] 2-methoxyethyl carbonate.
| Compound Name | [5-(5-amino-2,2-dimethylpentoxy)carbonyloxy-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl] 2-methoxyethyl carbonate |
|---|---|
| PubChem CID | 70388119 |
| Molecular Formula | C25H35N3O9 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | [5-(5-amino-2,2-dimethylpentoxy)carbonyloxy-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl] 2-methoxyethyl carbonate |
| SMILES | COCCOC(=O)OC1=C(C)NC(C)=C(OC(=O)OCC(C)(C)CCCN)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H35N3O9/c1-16-21(36-23(29)34-13-12-33-5)20(18-8-6-9-19(14-18)28(31)32)22(17(2)27-16)37-24(30)35-15-25(3,4)10-7-11-26/h6,8-9,14,20,27H,7,10-13,15,26H2,1-5H3 |
| InChIKey | SFGGSXSINJSYIN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 161.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|