C23H22F2N2O6 — CID 70383689
[4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] 2-phenylethyl carbonate (PubChem CID 70383689) has the molecular formula C23H22F2N2O6 and a molecular weight of 460.43 g/mol. Its IUPAC name is [4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] 2-phenylethyl carbonate.
| Compound Name | [4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] 2-phenylethyl carbonate |
|---|---|
| PubChem CID | 70383689 |
| Molecular Formula | C23H22F2N2O6 |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | [4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] 2-phenylethyl carbonate |
| SMILES | CC1=C(OC(=O)OCCc2ccccc2)C(c2ccccc2OC(F)F)C([N+](=O)[O-])=C(C)N1 |
| InChI | InChI=1S/C23H22F2N2O6/c1-14-20(27(29)30)19(17-10-6-7-11-18(17)32-22(24)25)21(15(2)26-14)33-23(28)31-13-12-16-8-4-3-5-9-16/h3-11,19,22,26H,12-13H2,1-2H3 |
| InChIKey | CVTIDXBOCZSMSB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|