C15H14F2N2O5 — CID 71454743
methyl 4-[2-(difluoromethoxy)phenyl]-2-methyl-5-nitro-1,4-dihydropyridine-3-carboxylate (PubChem CID 71454743) has the molecular formula C15H14F2N2O5 and a molecular weight of 340.28 g/mol. Its IUPAC name is methyl 4-[2-(difluoromethoxy)phenyl]-2-methyl-5-nitro-1,4-dihydropyridine-3-carboxylate.
| Compound Name | methyl 4-[2-(difluoromethoxy)phenyl]-2-methyl-5-nitro-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 71454743 |
| Molecular Formula | C15H14F2N2O5 |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | methyl 4-[2-(difluoromethoxy)phenyl]-2-methyl-5-nitro-1,4-dihydropyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC=C([N+](=O)[O-])C1c1ccccc1OC(F)F |
| InChI | InChI=1S/C15H14F2N2O5/c1-8-12(14(20)23-2)13(10(7-18-8)19(21)22)9-5-3-4-6-11(9)24-15(16)17/h3-7,13,15,18H,1-2H3 |
| InChIKey | SPIODCSJRCJEBW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|