C26H31F2NO9 — CID 101173503
bis(2-methylpropanoyloxymethyl) 4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 101173503) has the molecular formula C26H31F2NO9 and a molecular weight of 539.53 g/mol. Its IUPAC name is bis(2-methylpropanoyloxymethyl) 4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(2-methylpropanoyloxymethyl) 4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 101173503 |
| Molecular Formula | C26H31F2NO9 |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | bis(2-methylpropanoyloxymethyl) 4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCOC(=O)C(C)C)C(c2ccccc2OC(F)F)C(C(=O)OCOC(=O)C(C)C)=C(C)N1 |
| InChI | InChI=1S/C26H31F2NO9/c1-13(2)22(30)34-11-36-24(32)19-15(5)29-16(6)20(25(33)37-12-35-23(31)14(3)4)21(19)17-9-7-8-10-18(17)38-26(27)28/h7-10,13-14,21,26,29H,11-12H2,1-6H3 |
| InChIKey | PEIRNTDKOZNZQI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|