C26H33F2NO8 — CID 10885892
5-O-(butanoyloxymethyl) 3-O-(2-propoxyethyl) 4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10885892) has the molecular formula C26H33F2NO8 and a molecular weight of 525.55 g/mol. Its IUPAC name is 5-O-(butanoyloxymethyl) 3-O-(2-propoxyethyl) 4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-(butanoyloxymethyl) 3-O-(2-propoxyethyl) 4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10885892 |
| Molecular Formula | C26H33F2NO8 |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | 5-O-(butanoyloxymethyl) 3-O-(2-propoxyethyl) 4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCCOCCOC(=O)C1=C(C)NC(C)=C(C(=O)OCOC(=O)CCC)C1c1ccccc1OC(F)F |
| InChI | InChI=1S/C26H33F2NO8/c1-5-9-20(30)35-15-36-25(32)22-17(4)29-16(3)21(24(31)34-14-13-33-12-6-2)23(22)18-10-7-8-11-19(18)37-26(27)28/h7-8,10-11,23,26,29H,5-6,9,12-15H2,1-4H3 |
| InChIKey | WQLATUKCVGOWQT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|