C19H24FNO3 — CID 21364284
methoxymethyl 4-(2-fluorophenyl)-2,6-dimethyl-5-propyl-1,4-dihydropyridine-3-carboxylate (PubChem CID 21364284) has the molecular formula C19H24FNO3 and a molecular weight of 333.40 g/mol. Its IUPAC name is methoxymethyl 4-(2-fluorophenyl)-2,6-dimethyl-5-propyl-1,4-dihydropyridine-3-carboxylate.
| Compound Name | methoxymethyl 4-(2-fluorophenyl)-2,6-dimethyl-5-propyl-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 21364284 |
| Molecular Formula | C19H24FNO3 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | methoxymethyl 4-(2-fluorophenyl)-2,6-dimethyl-5-propyl-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCCC1=C(C)NC(C)=C(C(=O)OCOC)C1c1ccccc1F |
| InChI | InChI=1S/C19H24FNO3/c1-5-8-14-12(2)21-13(3)17(19(22)24-11-23-4)18(14)15-9-6-7-10-16(15)20/h6-7,9-10,18,21H,5,8,11H2,1-4H3 |
| InChIKey | UKMDQETWFLKPES-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|