C22H24BrF4NO4 — CID 70069903
3-O-(6-bromohexyl) 5-O-methyl 4-(2-fluorophenyl)-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70069903) has the molecular formula C22H24BrF4NO4 and a molecular weight of 522.33 g/mol. Its IUPAC name is 3-O-(6-bromohexyl) 5-O-methyl 4-(2-fluorophenyl)-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-(6-bromohexyl) 5-O-methyl 4-(2-fluorophenyl)-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70069903 |
| Molecular Formula | C22H24BrF4NO4 |
| Molecular Weight | 522.33 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | 3-O-(6-bromohexyl) 5-O-methyl 4-(2-fluorophenyl)-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(F)(F)F)NC(C)=C(C(=O)OCCCCCCBr)C1c1ccccc1F |
| InChI | InChI=1S/C22H24BrF4NO4/c1-13-16(21(30)32-12-8-4-3-7-11-23)17(14-9-5-6-10-15(14)24)18(20(29)31-2)19(28-13)22(25,26)27/h5-6,9-10,17,28H,3-4,7-8,11-12H2,1-2H3 |
| InChIKey | FGRZFBJURMQECH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.33 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|