C20H20BrClF3NO4 — CID 70069318
3-O-(4-bromobutyl) 5-O-methyl 4-(2-chlorophenyl)-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70069318) has the molecular formula C20H20BrClF3NO4 and a molecular weight of 510.73 g/mol. Its IUPAC name is 3-O-(4-bromobutyl) 5-O-methyl 4-(2-chlorophenyl)-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-(4-bromobutyl) 5-O-methyl 4-(2-chlorophenyl)-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70069318 |
| Molecular Formula | C20H20BrClF3NO4 |
| Molecular Weight | 510.73 g/mol |
| Exact Mass | 509.02 |
| IUPAC Name | 3-O-(4-bromobutyl) 5-O-methyl 4-(2-chlorophenyl)-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(F)(F)F)NC(C)=C(C(=O)OCCCCBr)C1c1ccccc1Cl |
| InChI | InChI=1S/C20H20BrClF3NO4/c1-11-14(19(28)30-10-6-5-9-21)15(12-7-3-4-8-13(12)22)16(18(27)29-2)17(26-11)20(23,24)25/h3-4,7-8,15,26H,5-6,9-10H2,1-2H3 |
| InChIKey | RBSGGLNSYHYUCX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.73 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|