C24H33ClN2O4 — CID 67922756
3-O-ethyl 5-O-methyl (4S)-2-(7-aminoheptyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 67922756) has the molecular formula C24H33ClN2O4 and a molecular weight of 448.99 g/mol. Its IUPAC name is 3-O-ethyl 5-O-methyl (4S)-2-(7-aminoheptyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-ethyl 5-O-methyl (4S)-2-(7-aminoheptyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 67922756 |
| Molecular Formula | C24H33ClN2O4 |
| Molecular Weight | 448.99 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 3-O-ethyl 5-O-methyl (4S)-2-(7-aminoheptyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(CCCCCCCN)NC(C)=C(C(=O)OC)[C@@H]1c1ccccc1Cl |
| InChI | InChI=1S/C24H33ClN2O4/c1-4-31-24(29)22-19(14-8-6-5-7-11-15-26)27-16(2)20(23(28)30-3)21(22)17-12-9-10-13-18(17)25/h9-10,12-13,21,27H,4-8,11,14-15,26H2,1-3H3/t21-/m0/s1 |
| InChIKey | NONZYHKKXLLZCY-NRFANRHFSA-N |
| XLogP | 4.59 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.99 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|