C29H45ClN2O3 — CID 142855793
ethyl 2-(4-aminobutyl)-4-(2-chlorophenyl)-6-methyl-5-propanoyl-1,4-dihydropyridine-3-carboxylate;2-methylhexane (PubChem CID 142855793) has the molecular formula C29H45ClN2O3 and a molecular weight of 505.14 g/mol. Its IUPAC name is ethyl 2-(4-aminobutyl)-4-(2-chlorophenyl)-6-methyl-5-propanoyl-1,4-dihydropyridine-3-carboxylate;2-methylhexane.
| Compound Name | ethyl 2-(4-aminobutyl)-4-(2-chlorophenyl)-6-methyl-5-propanoyl-1,4-dihydropyridine-3-carboxylate;2-methylhexane |
|---|---|
| PubChem CID | 142855793 |
| Molecular Formula | C29H45ClN2O3 |
| Molecular Weight | 505.14 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | ethyl 2-(4-aminobutyl)-4-(2-chlorophenyl)-6-methyl-5-propanoyl-1,4-dihydropyridine-3-carboxylate;2-methylhexane |
| SMILES | CCCCC(C)C.CCOC(=O)C1=C(CCCCN)NC(C)=C(C(=O)CC)C1c1ccccc1Cl |
| InChI | InChI=1S/C22H29ClN2O3.C7H16/c1-4-18(26)19-14(3)25-17(12-8-9-13-24)21(22(27)28-5-2)20(19)15-10-6-7-11-16(15)23;1-4-5-6-7(2)3/h6-7,10-11,20,25H,4-5,8-9,12-13,24H2,1-3H3;7H,4-6H2,1-3H3 |
| InChIKey | ZVFLVZRWMREUBF-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.14 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|