C21H26ClNO5 — CID 59107092
ethyl 4-(2-chlorophenyl)-5-(2-hydroxyacetyl)-6-methyl-2-(propoxymethyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 59107092) has the molecular formula C21H26ClNO5 and a molecular weight of 407.89 g/mol. Its IUPAC name is ethyl 4-(2-chlorophenyl)-5-(2-hydroxyacetyl)-6-methyl-2-(propoxymethyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | ethyl 4-(2-chlorophenyl)-5-(2-hydroxyacetyl)-6-methyl-2-(propoxymethyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 59107092 |
| Molecular Formula | C21H26ClNO5 |
| Molecular Weight | 407.89 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | ethyl 4-(2-chlorophenyl)-5-(2-hydroxyacetyl)-6-methyl-2-(propoxymethyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCCOCC1=C(C(=O)OCC)C(c2ccccc2Cl)C(C(=O)CO)=C(C)N1 |
| InChI | InChI=1S/C21H26ClNO5/c1-4-10-27-12-16-20(21(26)28-5-2)19(14-8-6-7-9-15(14)22)18(13(3)23-16)17(25)11-24/h6-9,19,23-24H,4-5,10-12H2,1-3H3 |
| InChIKey | NQZWTUZTHOOJME-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.89 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|