C26H31ClN2O8S — CID 161402799
benzenesulfonic acid;ethyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-5-(2-hydroxyacetyl)-6-methyl-1,4-dihydropyridine-3-carboxylate (PubChem CID 161402799) has the molecular formula C26H31ClN2O8S and a molecular weight of 567.06 g/mol. Its IUPAC name is benzenesulfonic acid;ethyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-5-(2-hydroxyacetyl)-6-methyl-1,4-dihydropyridine-3-carboxylate.
| Compound Name | benzenesulfonic acid;ethyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-5-(2-hydroxyacetyl)-6-methyl-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 161402799 |
| Molecular Formula | C26H31ClN2O8S |
| Molecular Weight | 567.06 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | benzenesulfonic acid;ethyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-5-(2-hydroxyacetyl)-6-methyl-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(COCCN)NC(C)=C(C(=O)CO)C1c1ccccc1Cl.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C20H25ClN2O5.C6H6O3S/c1-3-28-20(26)19-15(11-27-9-8-22)23-12(2)17(16(25)10-24)18(19)13-6-4-5-7-14(13)21;7-10(8,9)6-4-2-1-3-5-6/h4-7,18,23-24H,3,8-11,22H2,1-2H3;1-5H,(H,7,8,9) |
| InChIKey | VULKWDBEBRRKOK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 165.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.06 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|