C26H30ClNO8S — CID 154731294
benzenesulfonic acid;5-O-ethyl 3-O-methyl 4-(2-chlorophenyl)-2-methyl-6-(1,1,2,2,2-pentadeuterioethoxymethyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 154731294) has the molecular formula C26H30ClNO8S and a molecular weight of 557.08 g/mol. Its IUPAC name is benzenesulfonic acid;5-O-ethyl 3-O-methyl 4-(2-chlorophenyl)-2-methyl-6-(1,1,2,2,2-pentadeuterioethoxymethyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | benzenesulfonic acid;5-O-ethyl 3-O-methyl 4-(2-chlorophenyl)-2-methyl-6-(1,1,2,2,2-pentadeuterioethoxymethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 154731294 |
| Molecular Formula | C26H30ClNO8S |
| Molecular Weight | 557.08 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | benzenesulfonic acid;5-O-ethyl 3-O-methyl 4-(2-chlorophenyl)-2-methyl-6-(1,1,2,2,2-pentadeuterioethoxymethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | O=S(=O)(O)c1ccccc1.[2H]C([2H])([2H])C([2H])([2H])OCC1=C(C(=O)OCC)C(c2ccccc2Cl)C(C(=O)OC)=C(C)N1 |
| InChI | InChI=1S/C20H24ClNO5.C6H6O3S/c1-5-26-11-15-18(20(24)27-6-2)17(13-9-7-8-10-14(13)21)16(12(3)22-15)19(23)25-4;7-10(8,9)6-4-2-1-3-5-6/h7-10,17,22H,5-6,11H2,1-4H3;1-5H,(H,7,8,9)/i1D3,5D2; |
| InChIKey | TYFJCFWLIZROJW-PAJIIYFZSA-N |
| XLogP | 4.26 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.08 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|