C29H22N6O4S2 — CID 72698148
3-N,5-N-bis(1,3-benzothiazol-2-yl)-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide (PubChem CID 72698148) has the molecular formula C29H22N6O4S2 and a molecular weight of 582.67 g/mol. Its IUPAC name is 3-N,5-N-bis(1,3-benzothiazol-2-yl)-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-bis(1,3-benzothiazol-2-yl)-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 72698148 |
| Molecular Formula | C29H22N6O4S2 |
| Molecular Weight | 582.67 g/mol |
| Exact Mass | 582.11 |
| IUPAC Name | 3-N,5-N-bis(1,3-benzothiazol-2-yl)-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide |
| SMILES | CC1=C(C(=O)Nc2nc3ccccc3s2)C(c2ccccc2[N+](=O)[O-])C(C(=O)Nc2nc3ccccc3s2)=C(C)N1 |
| InChI | InChI=1S/C29H22N6O4S2/c1-15-23(26(36)33-28-31-18-10-4-7-13-21(18)40-28)25(17-9-3-6-12-20(17)35(38)39)24(16(2)30-15)27(37)34-29-32-19-11-5-8-14-22(19)41-29/h3-14,25,30H,1-2H3,(H,31,33,36)(H,32,34,37) |
| InChIKey | GOUFYFHFZLVZCB-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.67 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|