C26H25N3O4S — CID 3693010
N-(1,3-benzothiazol-2-yl)-4-(2,3-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide (PubChem CID 3693010) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-(2,3-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-(2,3-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 3693010 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-(2,3-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
| SMILES | COc1cccc(C2C(C(=O)Nc3nc4ccccc4s3)=C(C)NC3=C2C(=O)CCC3)c1OC |
| InChI | InChI=1S/C26H25N3O4S/c1-14-21(25(31)29-26-28-16-9-4-5-13-20(16)34-26)22(23-17(27-14)10-7-11-18(23)30)15-8-6-12-19(32-2)24(15)33-3/h4-6,8-9,12-13,22,27H,7,10-11H2,1-3H3,(H,28,29,31) |
| InChIKey | BGLMZTYFXLQREZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |