C28H29N3O4S — CID 92848370
(4R)-N-(1,3-benzothiazol-2-yl)-4-(2,4-dimethoxyphenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 92848370) has the molecular formula C28H29N3O4S and a molecular weight of 503.62 g/mol. Its IUPAC name is (4R)-N-(1,3-benzothiazol-2-yl)-4-(2,4-dimethoxyphenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | (4R)-N-(1,3-benzothiazol-2-yl)-4-(2,4-dimethoxyphenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 92848370 |
| Molecular Formula | C28H29N3O4S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (4R)-N-(1,3-benzothiazol-2-yl)-4-(2,4-dimethoxyphenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | COc1ccc([C@H]2C(C(=O)Nc3nc4ccccc4s3)=C(C)NC3=C2C(=O)CC(C)(C)C3)c(OC)c1 |
| InChI | InChI=1S/C28H29N3O4S/c1-15-23(26(33)31-27-30-18-8-6-7-9-22(18)36-27)24(17-11-10-16(34-4)12-21(17)35-5)25-19(29-15)13-28(2,3)14-20(25)32/h6-12,24,29H,13-14H2,1-5H3,(H,30,31,33)/t24-/m0/s1 |
| InChIKey | XRJGFYOXKFFWIR-DEOSSOPVSA-N |
| XLogP | 5.56 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |