C29H30BrN3O5S — CID 98127347
(4R)-N-(5-bromo-1,3-benzothiazol-2-yl)-2,7,7-trimethyl-5-oxo-4-(2,4,5-trimethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 98127347) has the molecular formula C29H30BrN3O5S and a molecular weight of 612.55 g/mol. Its IUPAC name is (4R)-N-(5-bromo-1,3-benzothiazol-2-yl)-2,7,7-trimethyl-5-oxo-4-(2,4,5-trimethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | (4R)-N-(5-bromo-1,3-benzothiazol-2-yl)-2,7,7-trimethyl-5-oxo-4-(2,4,5-trimethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 98127347 |
| Molecular Formula | C29H30BrN3O5S |
| Molecular Weight | 612.55 g/mol |
| Exact Mass | 611.11 |
| IUPAC Name | (4R)-N-(5-bromo-1,3-benzothiazol-2-yl)-2,7,7-trimethyl-5-oxo-4-(2,4,5-trimethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | COc1cc(OC)c([C@H]2C(C(=O)Nc3nc4cc(Br)ccc4s3)=C(C)NC3=C2C(=O)CC(C)(C)C3)cc1OC |
| InChI | InChI=1S/C29H30BrN3O5S/c1-14-24(27(35)33-28-32-17-9-15(30)7-8-23(17)39-28)25(26-18(31-14)12-29(2,3)13-19(26)34)16-10-21(37-5)22(38-6)11-20(16)36-4/h7-11,25,31H,12-13H2,1-6H3,(H,32,33,35)/t25-/m0/s1 |
| InChIKey | GHHKHNBJQZMEPF-VWLOTQADSA-N |
| XLogP | 6.33 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.55 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |