C26H22BrCl2N3O2S — CID 44726618
N-(5-bromo-1,3-benzothiazol-2-yl)-4-(2,3-dichlorophenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 44726618) has the molecular formula C26H22BrCl2N3O2S and a molecular weight of 591.36 g/mol. Its IUPAC name is N-(5-bromo-1,3-benzothiazol-2-yl)-4-(2,3-dichlorophenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | N-(5-bromo-1,3-benzothiazol-2-yl)-4-(2,3-dichlorophenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 44726618 |
| Molecular Formula | C26H22BrCl2N3O2S |
| Molecular Weight | 591.36 g/mol |
| Exact Mass | 589.00 |
| IUPAC Name | N-(5-bromo-1,3-benzothiazol-2-yl)-4-(2,3-dichlorophenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2nc3cc(Br)ccc3s2)C(c2cccc(Cl)c2Cl)C2=C(CC(C)(C)CC2=O)N1 |
| InChI | InChI=1S/C26H22BrCl2N3O2S/c1-12-20(24(34)32-25-31-16-9-13(27)7-8-19(16)35-25)21(14-5-4-6-15(28)23(14)29)22-17(30-12)10-26(2,3)11-18(22)33/h4-9,21,30H,10-11H2,1-3H3,(H,31,32,34) |
| InChIKey | KQIKXUIHPLMSRE-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.36 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |