C27H26BrN3O2S — CID 124578542
(4S)-N-(5-bromo-1,3-benzothiazol-2-yl)-2,7,7-trimethyl-4-(4-methylphenyl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 124578542) has the molecular formula C27H26BrN3O2S and a molecular weight of 536.50 g/mol. Its IUPAC name is (4S)-N-(5-bromo-1,3-benzothiazol-2-yl)-2,7,7-trimethyl-4-(4-methylphenyl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | (4S)-N-(5-bromo-1,3-benzothiazol-2-yl)-2,7,7-trimethyl-4-(4-methylphenyl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 124578542 |
| Molecular Formula | C27H26BrN3O2S |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | (4S)-N-(5-bromo-1,3-benzothiazol-2-yl)-2,7,7-trimethyl-4-(4-methylphenyl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2nc3cc(Br)ccc3s2)[C@@H](c2ccc(C)cc2)C2=C(CC(C)(C)CC2=O)N1 |
| InChI | InChI=1S/C27H26BrN3O2S/c1-14-5-7-16(8-6-14)23-22(15(2)29-19-12-27(3,4)13-20(32)24(19)23)25(33)31-26-30-18-11-17(28)9-10-21(18)34-26/h5-11,23,29H,12-13H2,1-4H3,(H,30,31,33)/t23-/m1/s1 |
| InChIKey | QXZGFHNKTWZGNW-HSZRJFAPSA-N |
| XLogP | 6.61 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |